[6-(4-methoxyphenyl)-2-phenyl-5,6-dihydro-1,3,4-oxadiazin-4-yl]-phenyl-methanone structure
|
Common Name | [6-(4-methoxyphenyl)-2-phenyl-5,6-dihydro-1,3,4-oxadiazin-4-yl]-phenyl-methanone | ||
|---|---|---|---|---|
| CAS Number | 73239-82-4 | Molecular Weight | 372.41700 | |
| Density | 1.18g/cm3 | Boiling Point | 521.8ºC at 760 mmHg | |
| Molecular Formula | C23H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.4ºC | |
| Name | [6-(4-methoxyphenyl)-2-phenyl-5,6-dihydro-1,3,4-oxadiazin-4-yl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 521.8ºC at 760 mmHg |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.41700 |
| Flash Point | 269.4ºC |
| Exact Mass | 372.14700 |
| PSA | 51.13000 |
| LogP | 3.64420 |
| Index of Refraction | 1.61 |
| InChIKey | RHXNRQRNNFGWSU-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2CN(C(=O)c3ccccc3)N=C(c3ccccc3)O2)cc1 |
|
~%
[6-(4-methoxyph... CAS#:73239-82-4 |
| Literature: Bassam,F.; Jones,R.G. Journal of the Chemical Society, Chemical Communications, 1979 , p. 917 - 918 |
|
~%
[6-(4-methoxyph... CAS#:73239-82-4 |
| Literature: Bassam, Farideh; Jones, Richard G. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1985 , p. 1759 - 1766 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(4-Benzoyl-2-phenyl-5,6-dihydro-4H-1,3,4-oxadiazin-6-yl)phenyl methyl ether |
| 4-Benzoyl-6-(4-methoxyphenyl)-2-phenyl-5,6-dihydro-4H-1,3,4-oxadiazine |
| [6-(4-methoxyphenyl)-2-phenyl-5,6-dihydro-1,3,4-oxadiazin-4-yl]-phenyl-methanone |