2-amino-3-[(4-methoxyphenyl)methylsulfinyl]propanoic acid structure
|
Common Name | 2-amino-3-[(4-methoxyphenyl)methylsulfinyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 73243-09-1 | Molecular Weight | 257.30600 | |
| Density | 1.372g/cm3 | Boiling Point | 534.7ºC at 760 mmHg | |
| Molecular Formula | C11H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.2ºC | |
| Name | 2-amino-3-[(4-methoxyphenyl)methylsulfinyl]propanoic acid |
|---|
| Density | 1.372g/cm3 |
|---|---|
| Boiling Point | 534.7ºC at 760 mmHg |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.30600 |
| Flash Point | 277.2ºC |
| Exact Mass | 257.07200 |
| PSA | 108.83000 |
| LogP | 1.92180 |
| Index of Refraction | 1.617 |
| InChIKey | QCJDNLVTMDOYBN-UHFFFAOYSA-N |
| SMILES | COc1ccc(CS(=O)CC(N)C(=O)O)cc1 |
|
~%
2-amino-3-[(4-m... CAS#:73243-09-1 |
| Literature: Funakoshi; Fujii; Akaji; et al. Chemical and Pharmaceutical Bulletin, 1979 , vol. 27, # 9 p. 2151 - 2156 |
|
~%
2-amino-3-[(4-m... CAS#:73243-09-1 |
| Literature: Funakoshi; Fujii; Akaji; et al. Chemical and Pharmaceutical Bulletin, 1979 , vol. 27, # 9 p. 2151 - 2156 |