(1R*,2S*,6R*,7S*,8R*)-8-Phenyl-4-oxa-tricyclo[5.2.1.0*2,6*]decane-3,5-dione structure
|
Common Name | (1R*,2S*,6R*,7S*,8R*)-8-Phenyl-4-oxa-tricyclo[5.2.1.0*2,6*]decane-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 73252-09-2 | Molecular Weight | 242.27000 | |
| Density | 1.29g/cm3 | Boiling Point | 428.7ºC at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.6ºC | |
| Name | 5-Phenylhexahydro-4,7-methano-2-benzofuran-1,3-dione |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 428.7ºC at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 211.6ºC |
| Exact Mass | 242.09400 |
| PSA | 43.37000 |
| LogP | 2.12580 |
| Index of Refraction | 1.596 |
| InChIKey | QVZKCYULUXLGPJ-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C2C3CC(CC3c3ccccc3)C12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |