1H-Trindene,1,3,4,6,7,9-hexabromo-2,3,4,5,6,7,8,9-octahydro- structure
|
Common Name | 1H-Trindene,1,3,4,6,7,9-hexabromo-2,3,4,5,6,7,8,9-octahydro- | ||
|---|---|---|---|---|
| CAS Number | 73255-12-6 | Molecular Weight | 671.68000 | |
| Density | 2.555g/cm3 | Boiling Point | 509.1ºC at 760mmHg | |
| Molecular Formula | C15H12Br6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.6ºC | |
| Name | 1,3,4,6,7,9-hexabromo-2,3,4,5,6,7,8,9-octahydro-1H-cyclopenta[e]-as-indacene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.555g/cm3 |
|---|---|
| Boiling Point | 509.1ºC at 760mmHg |
| Molecular Formula | C15H12Br6 |
| Molecular Weight | 671.68000 |
| Flash Point | 251.6ºC |
| Exact Mass | 665.60400 |
| LogP | 8.51370 |
| Index of Refraction | 1.772 |
| InChIKey | AQGDCXRHIJHQNU-UHFFFAOYSA-N |
| SMILES | BrC1CC(Br)c2c1c1c(c3c2C(Br)CC3Br)C(Br)CC1Br |
| HS Code | 2903999090 |
|---|
|
~83%
1H-Trindene,1,3... CAS#:73255-12-6 |
| Literature: Gao, Zhong-Qiang; Wei, Jun-Fa; Shi, Xian-Ying; Yu, Jun Tetrahedron Letters, 2008 , vol. 49, # 42 p. 6126 - 6128 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1H-Trindene,3,4,6,7,9-hexabromo-2,3,4,5,6,7,8,9-octahydro |
| 1,3,4,6,7,9-hexabromotrindane |