4-[4-oxo-2-[(E)-2-phenylethenyl]quinazolin-3-yl]benzoic acid,piperazine structure
|
Common Name | 4-[4-oxo-2-[(E)-2-phenylethenyl]quinazolin-3-yl]benzoic acid,piperazine | ||
|---|---|---|---|---|
| CAS Number | 73265-28-8 | Molecular Weight | 822.90500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C50H42N6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4-oxo-2-[(E)-2-phenylethenyl]quinazolin-3-yl]benzoic acid,piperazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C50H42N6O6 |
|---|---|
| Molecular Weight | 822.90500 |
| Exact Mass | 822.31700 |
| PSA | 168.44000 |
| LogP | 8.34540 |
| InChIKey | VIHYBSJTDYARRA-ZQSWXEMLSA-N |
| SMILES | C1CNCCN1.O=C(O)c1ccc(-n2c(C=Cc3ccccc3)nc3ccccc3c2=O)cc1.O=C(O)c1ccc(-n2c(C=Cc3ccccc3)nc3ccccc3c2=O)cc1 |
| 4-(4-Oxo-2-(2-phenylethenyl)-3(4H)-quinazolinyl)benzoic acid compd. with piperazine (2:1) |
| Benzoic acid,4-(4-oxo-2-(2-phenylethenyl)-3(4H)-quinazolinyl)-,compd. with piperazine (2:1) |
| Piperazine 1,4-bis(4-(4-oxo-2-(2-phenylethenyl)-3(4H)-quinazolinyl)benzoate) |
| 4-[4-oxo-2-[(E)-2-phenylethenyl]quinazolin-3-yl]benzoic acid |