1-diphenoxyphosphorylethanamine
Modify Date: 2025-09-13 15:26:51
1-diphenoxyphosphorylethanamine structure
|
Common Name | 1-diphenoxyphosphorylethanamine | ||
|---|---|---|---|---|
| CAS Number | 73270-41-4 | Molecular Weight | 277.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-diphenoxyphosphorylethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16NO3P |
|---|---|
| Molecular Weight | 277.25600 |
| Exact Mass | 277.08700 |
| PSA | 71.36000 |
| LogP | 4.34250 |
| InChIKey | MDPJOJBNZKKURJ-UHFFFAOYSA-N |
| SMILES | CC(N)P(=O)(Oc1ccccc1)Oc1ccccc1 |
|
~%
1-diphenoxyphos... CAS#:73270-41-4 |
| Literature: Oleksyszyn,J. et al. Synthesis, 1979 , p. 985 - 986 |
|
~%
1-diphenoxyphos... CAS#:73270-41-4 |
| Literature: Wade, Herschel; Scanlan, Thomas S. Journal of the American Chemical Society, 1999 , vol. 121, # 7 p. 1434 - 1443 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Diphenyl 1-aminoethanphosphonat |
| Phosphonic acid,(1-aminoethyl)-,diphenyl ester |
| (L,D)-diphenyl 1-aminoethylphosphonate |