1-diphenoxyphosphoryl-2-methylpropan-1-amine structure
|
Common Name | 1-diphenoxyphosphoryl-2-methylpropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 73270-42-5 | Molecular Weight | 305.30900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-diphenoxyphosphoryl-2-methylpropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H20NO3P |
|---|---|
| Molecular Weight | 305.30900 |
| Exact Mass | 305.11800 |
| PSA | 71.36000 |
| LogP | 4.97860 |
| InChIKey | OFQJMBVXCZFBPC-UHFFFAOYSA-N |
| SMILES | CC(C)C(N)P(=O)(Oc1ccccc1)Oc1ccccc1 |
|
~%
1-diphenoxyphos... CAS#:73270-42-5 |
| Literature: Oleksyszyn,J. et al. Synthesis, 1979 , p. 985 - 986 |
|
~%
1-diphenoxyphos... CAS#:73270-42-5 |
| Literature: Wade, Herschel; Scanlan, Thomas S. Journal of the American Chemical Society, 1999 , vol. 121, # 7 p. 1434 - 1443 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonic acid,(1-amino-2-methylpropyl)-,diphenyl ester |
| diphenyl 1-amino-2-methylpropylphosphonate |
| Diphenyl 1-amino-2-methylpropanphosphonat |