4-tert-butyl-3-methylsulfanylspiro[thiete-2,9'-xanthene] structure
|
Common Name | 4-tert-butyl-3-methylsulfanylspiro[thiete-2,9'-xanthene] | ||
|---|---|---|---|---|
| CAS Number | 73280-78-1 | Molecular Weight | 340.50200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butyl-3-methylsulfanylspiro[thiete-2,9'-xanthene] |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H20OS2 |
|---|---|
| Molecular Weight | 340.50200 |
| Exact Mass | 340.09600 |
| PSA | 59.83000 |
| LogP | 6.40340 |
| InChIKey | XUKPHHXMTZQPSQ-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(C)(C)C)SC12c1ccccc1Oc1ccccc12 |
|
~49%
4-tert-butyl-3-... CAS#:73280-78-1 |
| Literature: Brouwer, A. C.; Bos, H. J. T. Recueil: Journal of the Royal Netherlands Chemical Society, 1984 , vol. 103, # 5 p. 152 - 164 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Xanthene-9-spiro-2'-<4'-tert-butyl-3'-(methylthio)thiete> |
| Spiro[2H-thiete-2,9'-[9H]xanthene],4-(1,1-dimethylethyl)-3-(methylthio) |
| 3-(methylthio)-4-(tert-butyl)thiete-2-spiro-9'-xanthene |