dibutoxy-(3-dibutoxyboranylphenyl)borane structure
|
Common Name | dibutoxy-(3-dibutoxyboranylphenyl)borane | ||
|---|---|---|---|---|
| CAS Number | 7330-44-1 | Molecular Weight | 390.17300 | |
| Density | 0.93g/cm3 | Boiling Point | 471.9ºC at 760 mmHg | |
| Molecular Formula | C22H40B2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.2ºC | |
| Name | dibutoxy-(3-dibutoxyboranylphenyl)borane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.93g/cm3 |
|---|---|
| Boiling Point | 471.9ºC at 760 mmHg |
| Molecular Formula | C22H40B2O4 |
| Molecular Weight | 390.17300 |
| Flash Point | 239.2ºC |
| Exact Mass | 390.31100 |
| PSA | 36.92000 |
| LogP | 4.34380 |
| Index of Refraction | 1.459 |
| InChIKey | MYKBPIMMYBFEJM-UHFFFAOYSA-N |
| SMILES | CCCCOB(OCCCC)c1cccc(B(OCCCC)OCCCC)c1 |
|
~71%
dibutoxy-(3-dib... CAS#:7330-44-1 |
| Literature: Morgan, Jacqueline; Pinhey, John T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1990 , p. 715 - 720 |
|
~%
dibutoxy-(3-dib... CAS#:7330-44-1 |
| Literature: Nielsen; McEwen Journal of the American Chemical Society, 1957 , vol. 79, p. 3081,3084 |
| Tetra-B-butoxy-B,B'-m-phenylen-bis-boran |
| tetrabutyl benzene-1,3-diylbisboronate |
| tetra-B-butoxy-B,B'-m-phenylene-bis-borane |
| 1,3-Bis-dibutoxyboryl-benzol |