N,N'-bis(4-chlorophenyl)-3-oxopentanediamide structure
|
Common Name | N,N'-bis(4-chlorophenyl)-3-oxopentanediamide | ||
|---|---|---|---|---|
| CAS Number | 73339-34-1 | Molecular Weight | 365.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-bis(4-chlorophenyl)-3-oxopentanediamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H14Cl2N2O3 |
|---|---|
| Molecular Weight | 365.21100 |
| Exact Mass | 364.03800 |
| PSA | 75.27000 |
| LogP | 4.06590 |
| InChIKey | YSIZAQBOKBDRCW-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)Nc1ccc(Cl)cc1)CC(=O)Nc1ccc(Cl)cc1 |
|
~79%
N,N'-bis(4-chlo... CAS#:73339-34-1 |
| Literature: Zayed, M. A.; Abou-Taleb, Salah A.; El-Morsy, M. M. S. Journal of the Indian Chemical Society, 1982 , vol. 59, # 8 p. 1013 - 1015 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-oxo-glutaric acid bis-(4-chloro-anilide) |
| Pentanediamide,N,N'-bis(4-chlorophenyl)-3-oxo |
| Acetondicarbonsaeure-bis-(4-chlor-anilid) |
| 3-Oxo-glutarsaeure-bis-(4-chlor-anilid) |