3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S)
Modify Date: 2026-09-20 19:18:50
3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S) structure
|
Common Name | 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S) | ||
|---|---|---|---|---|
| CAS Number | 73372-97-1 | Molecular Weight | 177.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7NO3 |
|---|---|
| Molecular Weight | 177.16 |
| InChIKey | HNYIOENSKUGAAX-CZQIOHHCSA-N |
| SMILES | [C-]#[N+]C1=CC2OC2(C=CC(=O)O)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S)? |
| A: Molecular formula of 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S) is C9H7NO3. |
| Q: What is the CAS number of 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S)? |
| A: CAS number of 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S) is 73372-97-1. |
| Q: What is the InChIKey of 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S)? |
| A: InChIKey of 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S) is HNYIOENSKUGAAX-CZQIOHHCSA-N. |
| Q: What is the English name of 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S)? |
| A: The English name of 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S) is 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S). |
| Q: What is the Chinese name of 73372-97-1? |
| A: Chinese name of 73372-97-1 is 73372-97-1. |
| Q: What is the molecular weight of 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S)? |
| A: Molecular weight of 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S) is 177.16. |
| Q: What is the SMILES notation of 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S)? |
| A: SMILES notation of 3-(3-Isocyano-6-oxabicyclo(3.1.0)hex-2-en-5-yl)acrylic acid, (1S,5S) is [C-]#[N+]C1=CC2OC2(C=CC(=O)O)C1. |