Morphinan-17-ethanol,6,7,8,14-tetradehydro-4,5-epoxy-3,6-dimethoxy-, (5a)- (9CI) structure
|
Common Name | Morphinan-17-ethanol,6,7,8,14-tetradehydro-4,5-epoxy-3,6-dimethoxy-, (5a)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 73378-04-8 | Molecular Weight | 341.40100 | |
| Density | 1.34g/cm3 | Boiling Point | 538.6ºC at 760mmHg | |
| Molecular Formula | C20H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.5ºC | |
| Name | 2-[(4S,12bR)-7,9-dimethoxy-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-yl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 538.6ºC at 760mmHg |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.40100 |
| Flash Point | 279.5ºC |
| Exact Mass | 341.16300 |
| PSA | 51.16000 |
| LogP | 1.72490 |
| Index of Refraction | 1.66 |
| InChIKey | ZKORZLGGEXKVCH-XLDGYAMZSA-N |
| SMILES | COC1=CC=C2C3Cc4ccc(OC)c5c4C2(CCN3CCO)C1O5 |
|
~69%
Morphinan-17-et... CAS#:73378-04-8 |
| Literature: Granchelli, Felix E.; Filer, Crist N.; Soloway, Albert H.; Neumeyer, John L. Journal of Organic Chemistry, 1980 , vol. 45, # 12 p. 2275 - 2278 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-2-Hydroxyethylnorthebaine |