9-methoxy-3-methyl-7-(1-phenyltetrazol-5-yl)oxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline structure
|
Common Name | 9-methoxy-3-methyl-7-(1-phenyltetrazol-5-yl)oxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline | ||
|---|---|---|---|---|
| CAS Number | 73378-07-1 | Molecular Weight | 443.49800 | |
| Density | 1.5g/cm3 | Boiling Point | 616.6ºC at 760 mmHg | |
| Molecular Formula | C25H25N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 326.7ºC | |
| Name | 9-methoxy-3-methyl-7-(1-phenyltetrazol-5-yl)oxy-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 616.6ºC at 760 mmHg |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.49800 |
| Flash Point | 326.7ºC |
| Exact Mass | 443.19600 |
| PSA | 74.53000 |
| LogP | 2.50140 |
| Index of Refraction | 1.763 |
| InChIKey | UPQLBICYPVVGMW-UHFFFAOYSA-N |
| SMILES | COc1ccc2c3c1OC1C(Oc4nnnn4-c4ccccc4)C=CC4C(C2)N(C)CCC341 |
|
~51%
9-methoxy-3-met... CAS#:73378-07-1 |
| Literature: Granchelli, Felix E.; Filer, Crist N.; Soloway, Albert H.; Neumeyer, John L. Journal of Organic Chemistry, 1980 , vol. 45, # 12 p. 2275 - 2278 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Codeine-6-(2-phenyltetrazole) Ether |