5-oxo-3-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid structure
|
Common Name | 5-oxo-3-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 7338-75-2 | Molecular Weight | 173.15000 | |
| Density | 2.08g/cm3 | Boiling Point | 498.5ºC at 760 mmHg | |
| Molecular Formula | C4H3N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.3ºC | |
| Name | 5-oxo-3-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.08g/cm3 |
|---|---|
| Boiling Point | 498.5ºC at 760 mmHg |
| Molecular Formula | C4H3N3O3S |
| Molecular Weight | 173.15000 |
| Flash Point | 255.3ºC |
| Exact Mass | 172.99000 |
| PSA | 130.93000 |
| Index of Refraction | 1.862 |
| InChIKey | FNIWYYXBXXNBTQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1n[nH]c(=S)[nH]c1=O |
| HS Code | 2933699090 |
|---|
|
~%
5-oxo-3-sulfany... CAS#:7338-75-2 |
| Literature: Journal of the American Chemical Society, , vol. 78, p. 1938,1939 |
|
~%
5-oxo-3-sulfany... CAS#:7338-75-2 |
| Literature: Journal of the American Chemical Society, , vol. 78, p. 1258 |
|
~%
5-oxo-3-sulfany... CAS#:7338-75-2 |
| Literature: US4081441 A1, ; |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,2,4-triazine-3-thione-5-one-6-carboxylic acid |