N-benzyl-N-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)diazenyl]aniline,dimethyl sulfate structure
|
Common Name | N-benzyl-N-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)diazenyl]aniline,dimethyl sulfate | ||
|---|---|---|---|---|
| CAS Number | 73384-93-7 | Molecular Weight | 446.52300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26N6O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzyl-N-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)diazenyl]aniline,dimethyl sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H26N6O4S |
|---|---|
| Molecular Weight | 446.52300 |
| Exact Mass | 446.17400 |
| PSA | 119.65000 |
| LogP | 4.86180 |
| InChIKey | REMTYHOBUXNYER-UHFFFAOYSA-N |
| SMILES | CCN(Cc1ccccc1)c1ccc(N=Nc2nncn2C)cc1.COS(=O)(=O)OC |
| Sulfuric acid,dimethyl ester compd. with N-ethyl-N-(4-(2-(4-methyl-4H-1,2,4-triazol-3-yl)diazenyl)phenyl)benzenemethanamine (1:1) |
| Sulfuric acid,dimethyl ester,compd. with N-ethyl-N-(4-((4-methyl-4H-1,2,4-triazol-3-yl)azo)phenyl)benzenemethanamine (1:1) |