6,8,10-trichlorobenzo[a]phenoxazin-5-one structure
|
Common Name | 6,8,10-trichlorobenzo[a]phenoxazin-5-one | ||
|---|---|---|---|---|
| CAS Number | 73397-13-4 | Molecular Weight | 350.58300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H6Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,8,10-trichlorobenzo[a]phenoxazin-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H6Cl3NO2 |
|---|---|
| Molecular Weight | 350.58300 |
| Exact Mass | 348.94600 |
| PSA | 43.10000 |
| LogP | 5.40620 |
| InChIKey | ZECPQTSMSWKMKF-UHFFFAOYSA-N |
| SMILES | O=c1c(Cl)c2oc3c(Cl)cc(Cl)cc3nc-2c2ccccc12 |
|
~88%
6,8,10-trichlor... CAS#:73397-13-4 |
| Literature: Agarwal, Nand L.; Schaefer, Wolfram Journal of Organic Chemistry, 1980 , vol. 45, # 11 p. 2155 - 2161 |
|
~1%
Detail
|
| Literature: Agarwal, Nand L.; Schaefer, Wolfram Journal of Organic Chemistry, 1980 , vol. 45, # 25 p. 5144 - 5149 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6,8,10-trichloro-5H-benzo<a>phenoxazin-5-one |
| 5H-Benzo[a]phenoxazin-5-one,6,8,10-trichloro |