7-amino-2-methyl-3-(2-methylphenyl)quinazolin-4-one structure
|
Common Name | 7-amino-2-methyl-3-(2-methylphenyl)quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 734-44-1 | Molecular Weight | 265.31000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-amino-2-methyl-3-(2-methylphenyl)quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15N3O |
|---|---|
| Molecular Weight | 265.31000 |
| Exact Mass | 265.12200 |
| PSA | 60.91000 |
| LogP | 3.16590 |
| InChIKey | SWFRTLIVJQMMEV-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-n1c(C)nc2cc(N)ccc2c1=O |
|
~%
7-amino-2-methy... CAS#:734-44-1 |
| Literature: El-Azab, Adel S.; Eltahir, Kamal E.H. Bioorganic and Medicinal Chemistry Letters, 2012 , vol. 22, # 5 p. 1879 - 1885 |
|
~%
7-amino-2-methy... CAS#:734-44-1 |
| Literature: El-Azab, Adel S.; Eltahir, Kamal E.H. Bioorganic and Medicinal Chemistry Letters, 2012 , vol. 22, # 5 p. 1879 - 1885 |
|
~%
7-amino-2-methy... CAS#:734-44-1 |
| Literature: El-Azab, Adel S.; Eltahir, Kamal E.H. Bioorganic and Medicinal Chemistry Letters, 2012 , vol. 22, # 5 p. 1879 - 1885 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 7-amino-2-methyl-3-o-tolyl-3H-quinazolin-4-one |
| 2-methyl-3-(2-methylphenyl)-7-amino-4(3H)-quinazolinone |
| 7-Amino-2-methyl-3-o-tolyl-3H-chinazolin-4-on |
| 4(3H)-Quinazolinone,7-amino-2-methyl-3-(2-methylphenyl) |
| 7-aminomethaqualone |
| 2-Methyl-3-<o-tolyl>-7-amino-chinazolon |