2-(6-carboxy-2,3-dimethylphenyl)-3,4-dimethylbenzoic acid structure
|
Common Name | 2-(6-carboxy-2,3-dimethylphenyl)-3,4-dimethylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 7343-07-9 | Molecular Weight | 298.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(6-carboxy-2,3-dimethylphenyl)-3,4-dimethylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H18O4 |
|---|---|
| Molecular Weight | 298.33300 |
| Exact Mass | 298.12100 |
| PSA | 74.60000 |
| LogP | 3.98360 |
| InChIKey | WMQMAPHIDBKMDL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)O)c(-c2c(C(=O)O)ccc(C)c2C)c1C |
|
~%
2-(6-carboxy-2,... CAS#:7343-07-9 |
| Literature: Karnes,H.A. et al. Journal of the American Chemical Society, 1965 , vol. 87, # 24 p. 5554 - 5558 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 5,5',6,6'-Tetramethyl-diphensaeure |
| [1,1'-Biphenyl]-2,2'-dicarboxylic acid,5,5',6,6'-tetramethyl |
| (+/-)-5,5',6,6'-tetramethyldiphenic acid |