[3-acetyloxy-2-(acetyloxymethyl)-2-nitro-propyl] acetate structure
|
Common Name | [3-acetyloxy-2-(acetyloxymethyl)-2-nitro-propyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 7344-23-2 | Molecular Weight | 277.22800 | |
| Density | 1.278g/cm3 | Boiling Point | 375.5ºC at 760 mmHg | |
| Molecular Formula | C10H15NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.6ºC | |
| Name | [3-acetyloxy-2-(acetyloxymethyl)-2-nitropropyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 375.5ºC at 760 mmHg |
| Molecular Formula | C10H15NO8 |
| Molecular Weight | 277.22800 |
| Flash Point | 156.6ºC |
| Exact Mass | 277.08000 |
| PSA | 124.72000 |
| LogP | 0.21440 |
| Index of Refraction | 1.462 |
| InChIKey | MESPONKCPLGERO-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(COC(C)=O)(COC(C)=O)[N+](=O)[O-] |
|
~77%
[3-acetyloxy-2-... CAS#:7344-23-2 |
| Literature: Guanti, Giuseppe; Banfi, Luca; Narisano, Enrica Journal of Organic Chemistry, 1992 , vol. 57, # 5 p. 1540 - 1554 |
|
~%
[3-acetyloxy-2-... CAS#:7344-23-2 |
| Literature: Hercules Powder Co. Patent: US2128136 , 1937 ; |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1,3-diacetoxy-2-acetoxymethyl-2-nitropropane |
| Propane,1,3-diacetoxy-2-acetoxymethyl-2-nitro |
| 1,3-Propanediol,2-hydroxymethyl-2-nitro-,triacetate |
| 1,3-Diacetoxy-2-acetoxymethyl-2-nitro-propan |
| tris(acetoxymethyl)-nitromethane |