dimethyl 1-benzothiophene-2,5-dicarboxylate structure
|
Common Name | dimethyl 1-benzothiophene-2,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 7345-76-8 | Molecular Weight | 250.27000 | |
| Density | 1.325g/cm3 | Boiling Point | 376.2ºC at 760 mmHg | |
| Molecular Formula | C12H10O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.3ºC | |
| Name | dimethyl 1-benzothiophene-2,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 376.2ºC at 760 mmHg |
| Molecular Formula | C12H10O4S |
| Molecular Weight | 250.27000 |
| Flash Point | 181.3ºC |
| Exact Mass | 250.03000 |
| PSA | 80.84000 |
| LogP | 2.47450 |
| Index of Refraction | 1.616 |
| InChIKey | XHEKZPXGTIMGQC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2sc(C(=O)OC)cc2c1 |
|
~%
dimethyl 1-benz... CAS#:7345-76-8 |
| Literature: Witter, David J.; Belvedere, Sandro; Chen, Liqiang; Secrist, J. Paul; Mosley, Ralph T.; Miller, Thomas A. Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 16 p. 4562 - 4567 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Dimethyl benzo(b)thiophene-2,5-dicarboxylate |