7,8-dimethoxyphenanthrene-1,4-dione structure
|
Common Name | 7,8-dimethoxyphenanthrene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 73453-73-3 | Molecular Weight | 268.26400 | |
| Density | 1.31g/cm3 | Boiling Point | 456.1ºC at 760 mmHg | |
| Molecular Formula | C16H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.1ºC | |
| Name | 7,8-dimethoxyphenanthrene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 456.1ºC at 760 mmHg |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26400 |
| Flash Point | 205.1ºC |
| Exact Mass | 268.07400 |
| PSA | 52.60000 |
| LogP | 2.79220 |
| Index of Refraction | 1.643 |
| InChIKey | NPZRSIKHZBZZSF-UHFFFAOYSA-N |
| SMILES | COc1ccc2c3c(ccc2c1OC)C(=O)C=CC3=O |
|
~63%
7,8-dimethoxyph... CAS#:73453-73-3 |
| Literature: Manning, Wayne B.; Kelly, Terence P.; Muschik, Gary M. Journal of Organic Chemistry, 1980 , vol. 45, # 12 p. 2535 - 2536 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7,8-Dimethoxy-1,4-phenanthraquinone |