3,4,5-Trichloro-6-hydroxypyridine-2-carboxylic acid structure
|
Common Name | 3,4,5-Trichloro-6-hydroxypyridine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 73455-14-8 | Molecular Weight | 242.444 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 451.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C6H2Cl3NO3 | Melting Point | >230ºC(dec.) | |
| MSDS | N/A | Flash Point | 227.0±28.7 °C | |
| Name | 3,4,5-trichloro-6-oxo-1H-pyridine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.7±45.0 °C at 760 mmHg |
| Melting Point | >230ºC(dec.) |
| Molecular Formula | C6H2Cl3NO3 |
| Molecular Weight | 242.444 |
| Flash Point | 227.0±28.7 °C |
| Exact Mass | 240.910019 |
| PSA | 70.42000 |
| LogP | 1.52 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | WTPUPXKVBBLQOQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1[nH]c(=O)c(Cl)c(Cl)c1Cl |
| Storage condition | -20?C Freezer |
| HS Code | 2933399090 |
|---|
|
~%
3,4,5-Trichloro... CAS#:73455-14-8 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 148, p. 13,16 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyridinecarboxylic acid, 3,4,5-trichloro-1,6-dihydro-6-oxo- |
| 3,4,5-Trichloro-6-oxo-1,6-dihydro-2-pyridinecarboxylic acid |
| 6-hydroxy-3,4,5-trichloropyridine-2-carboxylic acid |
| 3,4,5-Trichloro-6-hydroxypicolinic acid |
| 3,4,5-Trichlor-6-hydroxy-pyridin-2-carbonsaeure |
| 3,4,5-TRICHLORO-6-HYDROXYPYRIDINE-2-CARBOXYLIC ACID |
| 3,4,5-Trichloro-6-hydroxy-2-picolinic Acid |