H-Met-Met-OH structure
|
Common Name | H-Met-Met-OH | ||
|---|---|---|---|---|
| CAS Number | 7349-78-2 | Molecular Weight | 280.40700 | |
| Density | 1.237g/cm3 | Boiling Point | 555.1ºC at 760mmHg | |
| Molecular Formula | C10H20N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.5ºC | |
Use of H-Met-Met-OHH-Met-Met-OH (L-Methionyl-L-methionine) is a dipeptide composed of two methionine residues[1]. |
| Name | h-met-met-oh |
|---|---|
| Synonym | More Synonyms |
| Description | H-Met-Met-OH (L-Methionyl-L-methionine) is a dipeptide composed of two methionine residues[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 555.1ºC at 760mmHg |
| Molecular Formula | C10H20N2O3S2 |
| Molecular Weight | 280.40700 |
| Flash Point | 289.5ºC |
| Exact Mass | 280.09200 |
| PSA | 143.02000 |
| LogP | 1.48050 |
| InChIKey | ZYTPOUNUXRBYGW-YUMQZZPRSA-N |
| SMILES | CSCCC(N)C(=O)NC(CCSC)C(=O)O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Name: Binding affinity to human PepT2 in SKTP cells
Source: ChEMBL
Target: Solute carrier family 15 member 2
External Id: CHEMBL1817008
|
|
Name: Inhibition of nitrogen-starved wild type sigma1278b yeast Gap1-mediated amino acid up...
Source: ChEMBL
Target: General amino-acid permease GAP1
External Id: CHEMBL1228071
|
| methionyl-methionine |
| Met-Met-OH |
| Methionine,N-L-methionyl-,L |
| L-MET-MET |
| L-methionine dipeptide |
| L-Met-L-Met |
| L-methionyl-L-methionine |
| L-Met-L-Met-OH |
| Dimethionine |
| MET-MET |