N-Carbobenzyloxy-L-arginine hydrobromide structure
|
Common Name | N-Carbobenzyloxy-L-arginine hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 73496-41-0 | Molecular Weight | 389.245 | |
| Density | N/A | Boiling Point | 574ºC at 760 mmHg | |
| Molecular Formula | C14H21BrN4O4 | Melting Point | 177-179.5 ºC | |
| MSDS | N/A | Flash Point | 301ºC | |
Use of N-Carbobenzyloxy-L-arginine hydrobromideZ-Arg-OH·HBr is an arginine derivative[1]. |
| Name | N2-[(Benzyloxy)carbonyl]arginine hydrochloride (1:1) |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Arg-OH·HBr is an arginine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 574ºC at 760 mmHg |
|---|---|
| Melting Point | 177-179.5 ºC |
| Molecular Formula | C14H21BrN4O4 |
| Molecular Weight | 389.245 |
| Flash Point | 301ºC |
| Exact Mass | 388.074615 |
| PSA | 141.02000 |
| LogP | 2.82660 |
| InChIKey | WZPJZYZTTBHEDE-MERQFXBCSA-N |
| SMILES | Br.NC(N)=NCCCC(NC(=O)OCc1ccccc1)C(=O)O |
| WGK Germany | 3 |
|---|---|
| HS Code | 2925290090 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Arginine, N-[(phenylmethoxy)carbonyl]-, hydrochloride (1:1) |
| N-[(Benzyloxy)carbonyl]arginine hydrochloride (1:1) |
| Z-ARG-OHHCL |
| N-Carbobenzyloxy-L-arginine hydrobromide |
| Z-Arg-OH.HBr |
| MFCD00035001 |