4H-Pyran-4-thione,2,6-dimethyl-3,5-diphenyl- structure
|
Common Name | 4H-Pyran-4-thione,2,6-dimethyl-3,5-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 73499-29-3 | Molecular Weight | 292.39500 | |
| Density | 1.2g/cm3 | Boiling Point | 427.6ºC at 760 mmHg | |
| Molecular Formula | C19H16OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.4ºC | |
| Name | 2,6-dimethyl-3,5-diphenylpyran-4-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 427.6ºC at 760 mmHg |
| Molecular Formula | C19H16OS |
| Molecular Weight | 292.39500 |
| Flash Point | 212.4ºC |
| Exact Mass | 292.09200 |
| PSA | 45.23000 |
| LogP | 5.95990 |
| Index of Refraction | 1.657 |
| InChIKey | RJPSKYMOAGEJKT-UHFFFAOYSA-N |
| SMILES | Cc1oc(C)c(-c2ccccc2)c(=S)c1-c1ccccc1 |
|
~81%
4H-Pyran-4-thio... CAS#:73499-29-3 |
| Literature: Yamaoka, Hiroshi; Mishima, Ikuhiro; Hanafusa, Terukiyo Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 6 p. 1763 - 1764 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2.6-Dimethyl-3.5-diphenyl-4H-pyran-thion-(4) |
| 2,6-dimethyl-3,5-diphenyl-4H-pyran-4-thione |
| 2,6-dimethyl-3,5-diphenyl-pyran-4-thione |