N,2,2-tris(trimethylsilyl)ethenimine structure
|
Common Name | N,2,2-tris(trimethylsilyl)ethenimine | ||
|---|---|---|---|---|
| CAS Number | 7351-44-2 | Molecular Weight | 257.59500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H27NSi3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,2,2-tris(trimethylsilyl)ethenimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H27NSi3 |
|---|---|
| Molecular Weight | 257.59500 |
| Exact Mass | 257.14500 |
| PSA | 12.36000 |
| LogP | 4.17220 |
| InChIKey | UGKYYAJYTDYONV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N=C=C([Si](C)(C)C)[Si](C)(C)C |
|
~%
N,2,2-tris(trim... CAS#:7351-44-2 |
| Literature: Zarges, Wolfgang; Marsch, Michael; Harms, Klaus; Boche, Gernot Chemische Berichte, 1989 , vol. 122, p. 1307 - 1312 |
|
~%
N,2,2-tris(trim... CAS#:7351-44-2 |
| Literature: Gornowicz,G.A.; West,R. Journal of the American Chemical Society, 1971 , vol. 93, # 7 p. 1714 - 1720 |
|
~%
N,2,2-tris(trim... CAS#:7351-44-2 |
| Literature: Zarges, Wolfgang; Marsch, Michael; Harms, Klaus; Boche, Gernot Chemische Berichte, 1989 , vol. 122, p. 1307 - 1312 |
|
~%
N,2,2-tris(trim... CAS#:7351-44-2 |
| Literature: Zarges, Wolfgang; Marsch, Michael; Harms, Klaus; Boche, Gernot Chemische Berichte, 1989 , vol. 122, p. 1307 - 1312 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Bis-trimethylsilyl-keten-trimethylsilylimin |
| Silanamine,N-[bis(trimethylsilyl)ethenylidene]-1,1,1-trimethyl |
| N-[2,2-Bis(trimethylsilyl)ethenylidene](trimethyl)silanamine |