(5-CHLORO-2-METHOXYPHENYL)-4-PYRIDINYL-METHANONE structure
|
Common Name | (5-CHLORO-2-METHOXYPHENYL)-4-PYRIDINYL-METHANONE | ||
|---|---|---|---|---|
| CAS Number | 73511-41-8 | Molecular Weight | 377.56600 | |
| Density | 1.879g/cm3 | Boiling Point | 592.8ºC at 760 mmHg | |
| Molecular Formula | C11H9ClIN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.3ºC | |
| Name | 2-(5-chloro-7-iodoquinolin-8-yl)oxyacetohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.879g/cm3 |
|---|---|
| Boiling Point | 592.8ºC at 760 mmHg |
| Molecular Formula | C11H9ClIN3O2 |
| Molecular Weight | 377.56600 |
| Flash Point | 312.3ºC |
| Exact Mass | 376.94300 |
| PSA | 80.73000 |
| LogP | 3.40210 |
| Index of Refraction | 1.709 |
| InChIKey | CHXORLLNRDHFGR-UHFFFAOYSA-N |
| SMILES | NNC(=O)COc1c(I)cc(Cl)c2cccnc12 |
| HS Code | 2933499090 |
|---|
|
~%
(5-CHLORO-2-MET... CAS#:73511-41-8 |
| Literature: Soliman; Mokhtar; El Sadany Journal of Pharmaceutical Sciences, 1984 , vol. 73, # 3 p. 403 - 405 |
|
~%
(5-CHLORO-2-MET... CAS#:73511-41-8 |
| Literature: Soliman; Mokhtar; El Sadany Journal of Pharmaceutical Sciences, 1984 , vol. 73, # 3 p. 403 - 405 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-(5-Chlor-7-iodchinolyloxy)acethydrazid |
| (5-Chloro-7-iodo-quinolin-8-yloxy)-acetic acid hydrazide |