fosarilate structure
|
Common Name | fosarilate | ||
|---|---|---|---|---|
| CAS Number | 73514-87-1 | Molecular Weight | 378.82800 | |
| Density | 1.131g/cm3 | Boiling Point | 483.6ºC at 760 mmHg | |
| Molecular Formula | C17H28ClO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 411.6ºC | |
| Name | 2-chloro-1-(6-diethoxyphosphorylhexoxy)-4-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.131g/cm3 |
|---|---|
| Boiling Point | 483.6ºC at 760 mmHg |
| Molecular Formula | C17H28ClO5P |
| Molecular Weight | 378.82800 |
| Flash Point | 411.6ºC |
| Exact Mass | 378.13600 |
| PSA | 63.80000 |
| LogP | 5.55390 |
| Index of Refraction | 1.488 |
| InChIKey | QDGWHHFJDHIIOS-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CCCCCCOc1ccc(OC)cc1Cl)OCC |
|
~%
fosarilate CAS#:73514-87-1 |
| Literature: Sterling Drug Inc. Patent: US4182759 A1, 1980 ; |
|
~37%
fosarilate CAS#:73514-87-1 |
| Literature: Diana, G. D.; Zalay, E. S.; Salvador, U. J.; Pancic, F.; Steinberg, B. Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 691 - 694 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Fosarilatum |
| Fosarilato |
| Phosphonic acid,(6-(2-chloro-4-methoxyphenoxy)hexyl)-,diethyl ester |
| Fosarilate |
| Fosarilato [Spanish] |
| diethyl [6-(2-chloro-4-methoxyphenoxy)hexyl]phosphonate |
| Fosarilatum [Latin] |