2-chloro-1-(7-diethoxyphosphorylheptoxy)-4-methoxybenzene structure
|
Common Name | 2-chloro-1-(7-diethoxyphosphorylheptoxy)-4-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 73514-91-7 | Molecular Weight | 392.85500 | |
| Density | 1.118g/cm3 | Boiling Point | 495.3ºC at 760 mmHg | |
| Molecular Formula | C18H30ClO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 426.8ºC | |
| Name | 2-chloro-1-(7-diethoxyphosphorylheptoxy)-4-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 495.3ºC at 760 mmHg |
| Molecular Formula | C18H30ClO5P |
| Molecular Weight | 392.85500 |
| Flash Point | 426.8ºC |
| Exact Mass | 392.15200 |
| PSA | 63.80000 |
| LogP | 5.94400 |
| Index of Refraction | 1.487 |
| InChIKey | MREDQSIYWHUQQL-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CCCCCCCOc1ccc(OC)cc1Cl)OCC |
|
~%
2-chloro-1-(7-d... CAS#:73514-91-7 |
| Literature: Sterling Drug Inc. Patent: US4182759 A1, 1980 ; |
|
~38%
2-chloro-1-(7-d... CAS#:73514-91-7 |
| Literature: Diana, G. D.; Zalay, E. S.; Salvador, U. J.; Pancic, F.; Steinberg, B. Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 691 - 694 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonic acid,(7-(2-chloro-4-methoxyphenoxy)heptyl)-,diethyl ester |
| Diethyl [7-(2-chloro-4-methoxyphenoxy)heptyl]phosphonate |