8-(2-chloro-4-methoxyphenoxy)-3-diethoxyphosphoryloctan-2-one structure
|
Common Name | 8-(2-chloro-4-methoxyphenoxy)-3-diethoxyphosphoryloctan-2-one | ||
|---|---|---|---|---|
| CAS Number | 73514-99-5 | Molecular Weight | 420.86500 | |
| Density | 1.151g/cm3 | Boiling Point | 548.2ºC at 760 mmHg | |
| Molecular Formula | C19H30ClO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 495.2ºC | |
| Name | 8-(2-chloro-4-methoxyphenoxy)-3-diethoxyphosphoryloctan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 548.2ºC at 760 mmHg |
| Molecular Formula | C19H30ClO6P |
| Molecular Weight | 420.86500 |
| Flash Point | 495.2ºC |
| Exact Mass | 420.14700 |
| PSA | 80.87000 |
| LogP | 5.51150 |
| Index of Refraction | 1.491 |
| InChIKey | PEEDSHQHQPWGTI-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(CCCCCOc1ccc(OC)cc1Cl)C(C)=O |
|
~%
8-(2-chloro-4-m... CAS#:73514-99-5 |
| Literature: Sterling Drug Inc. Patent: US4182759 A1, 1980 ; |
|
~%
8-(2-chloro-4-m... CAS#:73514-99-5 |
| Literature: Diana, G. D.; Zalay, E. S.; Salvador, U. J.; Pancic, F.; Steinberg, B. Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 691 - 694 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonic acid,[1-acetyl-6-(2-chloro-4-methoxyphenoxy)hexyl]-,diethyl ester |
| Diethyl [1-acetyl-6-(2-chloro-4-methoxyphenoxy)hexyl]-phosphonate |