9-(2-chloro-4-methoxyphenoxy)-3-diethoxyphosphorylnonan-2-one structure
|
Common Name | 9-(2-chloro-4-methoxyphenoxy)-3-diethoxyphosphorylnonan-2-one | ||
|---|---|---|---|---|
| CAS Number | 73515-01-2 | Molecular Weight | 434.89100 | |
| Density | 1.138g/cm3 | Boiling Point | 558.5ºC at 760 mmHg | |
| Molecular Formula | C20H32ClO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 508.5ºC | |
| Name | 9-(2-chloro-4-methoxyphenoxy)-3-diethoxyphosphorylnonan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 558.5ºC at 760 mmHg |
| Molecular Formula | C20H32ClO6P |
| Molecular Weight | 434.89100 |
| Flash Point | 508.5ºC |
| Exact Mass | 434.16300 |
| PSA | 80.87000 |
| LogP | 5.90160 |
| Index of Refraction | 1.49 |
| InChIKey | CHPSTQOVOUSELB-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)C(CCCCCCOc1ccc(OC)cc1Cl)C(C)=O |
|
~%
9-(2-chloro-4-m... CAS#:73515-01-2 |
| Literature: Diana, G. D.; Zalay, E. S.; Salvador, U. J.; Pancic, F.; Steinberg, B. Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 691 - 694 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: In vitro ability to inhibit the herpes HSV-2 virus
Source: ChEMBL
Target: Oryctolagus cuniculus
External Id: CHEMBL695781
|
| Diethyl [1-acetyl-7-(2-chloro-4-methoxyphenoxy)heptyl]-phosphonate |
| Phosphonic acid,(1-acetyl-7-(2-chloro-4-methoxyphenoxy)heptyl)-,diethyl ester |