ethyl 4-(6-diethoxyphosphorylhexoxy)benzoate structure
|
Common Name | ethyl 4-(6-diethoxyphosphorylhexoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 73515-02-3 | Molecular Weight | 386.42000 | |
| Density | 1.093g/cm3 | Boiling Point | 497.4ºC at 760mmHg | |
| Molecular Formula | C19H31O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(6-diethoxyphosphorylhexoxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.093g/cm3 |
|---|---|
| Boiling Point | 497.4ºC at 760mmHg |
| Molecular Formula | C19H31O6P |
| Molecular Weight | 386.42000 |
| Exact Mass | 386.18600 |
| PSA | 80.87000 |
| LogP | 5.06860 |
| Index of Refraction | 1.485 |
| InChIKey | NMVJWSZGNNBFMW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OCCCCCCP(=O)(OCC)OCC)cc1 |
|
~%
ethyl 4-(6-diet... CAS#:73515-02-3 |
| Literature: Sterling Drug Inc. Patent: US4182759 A1, 1980 ; |
|
~49%
ethyl 4-(6-diet... CAS#:73515-02-3 |
| Literature: Diana, G. D.; Zalay, E. S.; Salvador, U. J.; Pancic, F.; Steinberg, B. Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 691 - 694 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| diethyl [6-(4-carbethoxyphenoxy)hexyl]phosphonate |
| Benzoic acid,4-((6-(diethoxyphosphinyl)hexyl)oxy)-,ethyl ester |