cis-3-(4-methoxybenzoyl)cyclohexane-1-carboxylic acid
Modify Date: 2025-09-22 10:01:26
cis-3-(4-methoxybenzoyl)cyclohexane-1-carboxylic acid structure
|
Common Name | cis-3-(4-methoxybenzoyl)cyclohexane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 735269-73-5 | Molecular Weight | 262.30100 | |
| Density | 1.193g/cm3 | Boiling Point | 461.9ºC at 760 mmHg | |
| Molecular Formula | C15H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.5ºC | |
| Name | cis-3-(4-methoxybenzoyl)cyclohexane-1-carboxylic acid |
|---|
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 461.9ºC at 760 mmHg |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30100 |
| Flash Point | 173.5ºC |
| Exact Mass | 262.12100 |
| PSA | 63.60000 |
| LogP | 2.76890 |
| Index of Refraction | 1.551 |
| InChIKey | MFVOLQHUPMQCRA-NWDGAFQWSA-N |
| SMILES | COc1ccc(C(=O)C2CCCC(C(=O)O)C2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |