cis-3-[2-(3-methoxyphenyl)-2-oxoethyl]cyclohexane-1-carboxylic acid structure
|
Common Name | cis-3-[2-(3-methoxyphenyl)-2-oxoethyl]cyclohexane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 735275-09-9 | Molecular Weight | 276.32800 | |
| Density | 1.152g/cm3 | Boiling Point | 448.2ºC at 760 mmHg | |
| Molecular Formula | C16H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164ºC | |
| Name | cis-3-[2-(3-methoxyphenyl)-2-oxoethyl]cyclohexane-1-carboxylic acid |
|---|
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 448.2ºC at 760 mmHg |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.32800 |
| Flash Point | 164ºC |
| Exact Mass | 276.13600 |
| PSA | 63.60000 |
| LogP | 3.15900 |
| Index of Refraction | 1.536 |
| InChIKey | QBKJSKIEJWQADW-WCQYABFASA-N |
| SMILES | COc1cccc(C(=O)CC2CCCC(C(=O)O)C2)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |