2-methylbutyl prop-2-enoate,oxiran-2-ylmethyl 2-methylprop-2-enoate,prop-2-enoic acid structure
|
Common Name | 2-methylbutyl prop-2-enoate,oxiran-2-ylmethyl 2-methylprop-2-enoate,prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 73545-25-2 | Molecular Weight | 356.41100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H28O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylbutyl prop-2-enoate,oxiran-2-ylmethyl 2-methylprop-2-enoate,prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H28O7 |
|---|---|
| Molecular Weight | 356.41100 |
| Exact Mass | 356.18400 |
| PSA | 102.43000 |
| LogP | 2.52320 |
| InChIKey | GOEWFYHHJIIBPN-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC1CO1.C=CC(=O)O.C=CC(=O)OCC(C)CC |
| Acrylic acid,2-methylbutyl acrylate,oxiranylmethyl methacrylate polymer |
| 2-Propenoic acid,2-methyl-,2-oxiranylmethyl ester,polymer with 2-methylbutyl 2-propenoate and 2-propenoic acid |
| 2-Propenoic acid,2-methyl-,oxiranylmethyl ester,polymer with 2-methylbutyl 2-propenoate and 2-propenoic acid |