4-acetamido-α-oxophenylacetic acid
4-acetamido-α-oxophenylacetic acid structure
|
Common Name | 4-acetamido-α-oxophenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 73549-48-1 | Molecular Weight | 207.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-acetamido-α-oxophenylacetic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9NO4 |
|---|---|
| Molecular Weight | 207.18300 |
| Exact Mass | 207.05300 |
| PSA | 83.47000 |
| LogP | 0.98530 |
| InChIKey | UFVLZQLMKNSJDY-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)C(=O)O)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:15535-99-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-acetylaminophenylglyoxylic acid |
| (4-Acetylamino-phenyl)-glyoxylsaeure |
| p-Acetamino-phenylglyoxylsaeure |
| (4-acetylamino-phenyl)-glyoxylic acid |
| 4-Acetamino-benzoylameisensaeure |
| (4-Acetamino-phenyl)-glyoxylsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-acetamido-α-oxophenylacetic acid? |
| A: Molecular weight of 4-acetamido-α-oxophenylacetic acid is 207.18300. |
| Q: What are the downstream products of 4-acetamido-α-oxophenylacetic acid? |
| A: Related downstream products(CAS) of 4-acetamido-α-oxophenylacetic acid: 15535-99-6. |
| Q: What is the polar surface area (PSA) of 4-acetamido-α-oxophenylacetic acid? |
| A: Polar surface area (PSA) of 4-acetamido-α-oxophenylacetic acid is 83.47000. |
| Q: What is the CAS number of 4-acetamido-α-oxophenylacetic acid? |
| A: CAS number of 4-acetamido-α-oxophenylacetic acid is 73549-48-1. |
| Q: What is the Chinese name of 73549-48-1? |
| A: Chinese name of 73549-48-1 is 73549-48-1. |
| Q: What is the InChIKey of 4-acetamido-α-oxophenylacetic acid? |
| A: InChIKey of 4-acetamido-α-oxophenylacetic acid is UFVLZQLMKNSJDY-UHFFFAOYSA-N. |
| Q: What English synonyms does 4-acetamido-α-oxophenylacetic acid have? |
| A: English synonyms of 4-acetamido-α-oxophenylacetic acid: p-acetylaminophenylglyoxylic acid, (4-Acetylamino-phenyl)-glyoxylsaeure, p-Acetamino-phenylglyoxylsaeure, (4-acetylamino-phenyl)-glyoxylic acid, 4-Acetamino-benzoylameisensaeure, (4-Acetamino-phenyl)-glyoxylsaeure. |
| Q: What is the English name of 4-acetamido-α-oxophenylacetic acid? |
| A: The English name of 4-acetamido-α-oxophenylacetic acid is 4-acetamido-α-oxophenylacetic acid. |
| Q: What is the LogP of 4-acetamido-α-oxophenylacetic acid? |
| A: LogP of 4-acetamido-α-oxophenylacetic acid is 0.98530. |
| Q: What is the SMILES notation of 4-acetamido-α-oxophenylacetic acid? |
| A: SMILES notation of 4-acetamido-α-oxophenylacetic acid is CC(=O)Nc1ccc(C(=O)C(=O)O)cc1. |