Benzenamine,4,4'-[(3,4-dimethoxyphenyl)methylene]bis[N,N-dimethyl- structure
|
Common Name | Benzenamine,4,4'-[(3,4-dimethoxyphenyl)methylene]bis[N,N-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 7355-20-6 | Molecular Weight | 390.51800 | |
| Density | 1.094g/cm3 | Boiling Point | 530.9ºC at 760 mmHg | |
| Molecular Formula | C25H30N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.5ºC | |
| Name | 4-[(3,4-dimethoxyphenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.094g/cm3 |
|---|---|
| Boiling Point | 530.9ºC at 760 mmHg |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.51800 |
| Flash Point | 145.5ºC |
| Exact Mass | 390.23100 |
| PSA | 24.94000 |
| LogP | 5.01600 |
| Index of Refraction | 1.599 |
| InChIKey | CFCBEZIWTCSEKQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1OC |
|
~56%
Benzenamine,4,4... CAS#:7355-20-6 |
| Literature: Bardajee, Ghasem Rezanejade Beilstein Journal of Organic Chemistry, 2011 , vol. 7, p. 135 - 144 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4'.4''-Bis-dimethylamino-3.4-dimethoxy-triphenylmethan |
| (3,4-Dimethoxy-phenyl)-bis-(4-dimethylamino-phenyl)-methan |
| 3,4-dimethoxyphenyl-bis[4-(dimethylamino)phenyl]methane |
| 4,4'-[(3,4-dimethoxyphenyl)methanediyl]bis(n,n-dimethylaniline) |
| 4-[(3,4-DIMETHOXYPHENYL)-(4-DIMETHYLAMINOPHENYL)METHYL]-N,N-DIMETHYL-A NILINE |