4-(cinnamylideneamino)-5-methyl-2-propan-2-yl-phenol structure
|
Common Name | 4-(cinnamylideneamino)-5-methyl-2-propan-2-yl-phenol | ||
|---|---|---|---|---|
| CAS Number | 7355-30-8 | Molecular Weight | 279.37600 | |
| Density | 0.99g/cm3 | Boiling Point | 464.8ºC at 760 mmHg | |
| Molecular Formula | C19H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.4ºC | |
| Name | 5-methyl-4-[[(E)-3-phenylprop-2-enylidene]amino]-2-propan-2-ylphenol |
|---|
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 464.8ºC at 760 mmHg |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.37600 |
| Flash Point | 306.4ºC |
| Exact Mass | 279.16200 |
| PSA | 32.59000 |
| LogP | 5.23970 |
| Index of Refraction | 1.541 |
| InChIKey | WGSOFWGAEOWGGL-NZLLKADESA-N |
| SMILES | Cc1cc(O)c(C(C)C)cc1N=CC=Cc1ccccc1 |
|
~%
4-(cinnamyliden... CAS#:7355-30-8 |
| Literature: Sumerford; Hartung; Jenkins Journal of the American Chemical Society, 1940 , vol. 62, p. 2082 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |