Benzoic acid,4-(2-cyclohexen-1-yloxy)-
Modify Date: 2025-09-13 18:03:17
Benzoic acid,4-(2-cyclohexen-1-yloxy)- structure
|
Common Name | Benzoic acid,4-(2-cyclohexen-1-yloxy)- | ||
|---|---|---|---|---|
| CAS Number | 7355-51-3 | Molecular Weight | 218.24800 | |
| Density | 1.2g/cm3 | Boiling Point | 369.9ºC at 760 mmHg | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.9ºC | |
| Name | 4-cyclohex-2-en-1-yloxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 369.9ºC at 760 mmHg |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.24800 |
| Flash Point | 141.9ºC |
| Exact Mass | 218.09400 |
| PSA | 46.53000 |
| LogP | 2.87230 |
| Index of Refraction | 1.58 |
| InChIKey | PDVBRFKIRWATOO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OC2C=CCCC2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| para-2-Cyclohexenyloxybenzoic acid |
| 4-Cyclohex-2-enyloxy-benzoesaeure |