1,2-Hydrazinedicarboxylicacid, 1-(2,4-cyclohexadien-1-yl)-, 1,2-diethyl ester structure
|
Common Name | 1,2-Hydrazinedicarboxylicacid, 1-(2,4-cyclohexadien-1-yl)-, 1,2-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7355-78-4 | Molecular Weight | 254.28200 | |
| Density | 1.17g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-cyclohexa-2,4-dien-1-yl-N-(ethoxycarbonylamino)carbamate |
|---|
| Density | 1.17g/cm3 |
|---|---|
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.28200 |
| Exact Mass | 254.12700 |
| PSA | 67.87000 |
| LogP | 2.38160 |
| Index of Refraction | 1.528 |
| InChIKey | ZCFXZIRRGSOGPH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NN(C(=O)OCC)C1C=CC=CC1 |
|
~%
1,2-Hydrazinedi... CAS#:7355-78-4 |
| Literature: Jenner, Gerard; Salem, Ridha Ben Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1990 , # 11 p. 1961 - 1964 |
|
~%
Detail
|
| Literature: Jenner, Gerard; Salem, Ridha Ben Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1990 , # 11 p. 1961 - 1964 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |