Arsonous diiodide,[4-(4-phenoxybenzoyl)phenyl]- (9CI) structure
|
Common Name | Arsonous diiodide,[4-(4-phenoxybenzoyl)phenyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 7356-67-4 | Molecular Weight | 602.03600 | |
| Density | N/A | Boiling Point | 556.2ºC at 760 mmHg | |
| Molecular Formula | C19H13AsI2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.2ºC | |
| Name | (4-diiodoarsanylphenyl)-(4-phenoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 556.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H13AsI2O2 |
| Molecular Weight | 602.03600 |
| Flash Point | 290.2ºC |
| Exact Mass | 601.82200 |
| PSA | 26.30000 |
| LogP | 5.27510 |
| InChIKey | CFLBLPWSNKOODH-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1)c1ccc([As](I)I)cc1 |
|
~%
Arsonous diiodi... CAS#:7356-67-4 |
| Literature: Blicke; Powers; Webster Journal of the American Chemical Society, 1932 , vol. 54, p. 2946 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Dijodarsino-4'-phenoxy-benzophenon |
| 4-diiodoarsino-4'-phenoxy-benzophenone |
| [4-(4-phenoxybenzoyl)phenyl]arsonous diiodide |