ethyl 5-oxo-2,3-diphenyl-cyclopentane-1-carboxylate structure
|
Common Name | ethyl 5-oxo-2,3-diphenyl-cyclopentane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 7356-94-7 | Molecular Weight | 308.37100 | |
| Density | 1.151g/cm3 | Boiling Point | 435.9ºC at 760 mmHg | |
| Molecular Formula | C20H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.9ºC | |
| Name | ethyl 5-oxo-2,3-diphenylcyclopentane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 435.9ºC at 760 mmHg |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.37100 |
| Flash Point | 190.9ºC |
| Exact Mass | 308.14100 |
| PSA | 43.37000 |
| LogP | 3.70610 |
| Index of Refraction | 1.568 |
| InChIKey | KOOALXZQBUUFEG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(=O)CC(c2ccccc2)C1c1ccccc1 |
|
~39%
ethyl 5-oxo-2,3... CAS#:7356-94-7
Detail
|
| Literature: Hess, Ulrich; Huhn, Dietmar Zeitschrift fuer Chemie (Stuttgart, Germany), 1987 , vol. 27, # 8 p. 296 |
|
~%
ethyl 5-oxo-2,3... CAS#:7356-94-7 |
| Literature: Mash, Eugene A.; Hemperly, Susan B.; Nelson, Keith A.; Heidt, Philip C.; Deusen, Shawne Van Journal of Organic Chemistry, 1990 , vol. 55, # 7 p. 2045 - 2055 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-Aethoxycarbonyl-3,4-diphenyl-cyclopentanon-(1) |
| 2,3-Diphenyl-5-oxo-cyclopentancarbonsaeureethylester |
| 2-Carbaethoxy-3,4-diphenyl-cyclopoentanon |
| 2-Carbaethoxy-3,4-diphenyl-cyclopentanon |
| 2-carbethoxy-3,4-diphenylcyclopentanone |
| ethyl 5-oxo-2,3-diphenylcyclopentanecarboxylate |