2-isoquinolin-2-yl-1-naphthalen-1-yl-ethanone structure
|
Common Name | 2-isoquinolin-2-yl-1-naphthalen-1-yl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 7357-47-3 | Molecular Weight | 378.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-isoquinolin-2-ium-2-yl-1-naphthalen-1-ylethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H16BrNO |
|---|---|
| Molecular Weight | 378.26200 |
| Exact Mass | 377.04200 |
| PSA | 20.95000 |
| LogP | 1.16740 |
| InChIKey | XSKKUPNYABOFQX-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1ccc2ccccc2c1)c1cccc2ccccc12.[Br-] |
|
~%
2-isoquinolin-2... CAS#:7357-47-3 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1946 , vol. 68, p. 1131 |
| 2-(2-[1]Naphthyl-2-oxo-aethyl)-isochinolinium,Bromid |
| 2-[2-(1-naphthyl)-2-oxoethyl]isoquinolinium |
| 2-(2-[1]naphthyl-2-oxo-ethyl)-isoquinolinium,bromide |
| 2-isoquinolin-2-ium-2-yl-1-naphthalen-1-ylethanone |
| HMS2610K05 |