1H-Indole-3-aceticacid, 2,5,7-trimethyl-, ethyl ester structure
|
Common Name | 1H-Indole-3-aceticacid, 2,5,7-trimethyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7357-49-5 | Molecular Weight | 245.31700 | |
| Density | 1.115g/cm3 | Boiling Point | 388.3ºC at 760 mmHg | |
| Molecular Formula | C15H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.6ºC | |
| Name | ethyl 2-(2,5,7-trimethyl-1H-indol-3-yl)acetate |
|---|
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 388.3ºC at 760 mmHg |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.31700 |
| Flash Point | 188.6ºC |
| Exact Mass | 245.14200 |
| PSA | 42.09000 |
| LogP | 3.19870 |
| Index of Refraction | 1.583 |
| InChIKey | GFDBFMJBAWLKJL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1c(C)[nH]c2c(C)cc(C)cc12 |
|
~%
1H-Indole-3-ace... CAS#:7357-49-5 |
| Literature: Bullock; Hand Journal of the American Chemical Society, 1956 , vol. 78, p. 5854,5856 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |