Propanenitrile,3,3'-[[1-(phenoxymethyl)-1,2-ethanediyl]bis(oxy)]bis- (9CI) structure
|
Common Name | Propanenitrile,3,3'-[[1-(phenoxymethyl)-1,2-ethanediyl]bis(oxy)]bis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 7357-50-8 | Molecular Weight | 274.31500 | |
| Density | 1.118g/cm3 | Boiling Point | 484.1ºC at 760mmHg | |
| Molecular Formula | C15H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.6ºC | |
| Name | 3-[2-(2-cyanoethoxy)-3-phenoxypropoxy]propanenitrile |
|---|
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 484.1ºC at 760mmHg |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.31500 |
| Flash Point | 192.6ºC |
| Exact Mass | 274.13200 |
| PSA | 75.27000 |
| LogP | 2.29456 |
| Index of Refraction | 1.509 |
| InChIKey | GRFIAICZPZTDMN-UHFFFAOYSA-N |
| SMILES | N#CCCOCC(COc1ccccc1)OCCC#N |
|
~%
Propanenitrile,... CAS#:7357-50-8 |
| Literature: Resinous Prod. and Chem. Co. Patent: US2401607 , 1944 ; Full Text Show Details Resinous Prod. and Chem. Co. Patent: US2437905 , 1945 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |