2-methylsulfonyl-5H-purin-6-amine
2-methylsulfonyl-5H-purin-6-amine structure
|
Common Name | 2-methylsulfonyl-5H-purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 7357-53-1 | Molecular Weight | 213.21700 | |
| Density | 1.98g/cm3 | Boiling Point | 415.7ºC at 760 mmHg | |
| Molecular Formula | C6H7N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methylsulfonyl-7H-purin-6-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.98g/cm3 |
|---|---|
| Boiling Point | 415.7ºC at 760 mmHg |
| Molecular Formula | C6H7N5O2S |
| Molecular Weight | 213.21700 |
| Flash Point | 205.2ºC |
| Exact Mass | 213.03200 |
| PSA | 123.00000 |
| LogP | 1.00060 |
| Index of Refraction | 1.872 |
| InChIKey | GFHIBTOBFWWCTL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1nc(N)c2[nH]cnc2n1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:3373-53-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Methylsulfonyl-adenin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 2-methylsulfonyl-7H-purin-6-amine? |
| A: Related downstream products(CAS) of 2-methylsulfonyl-7H-purin-6-amine: 3373-53-3. |
| Q: What is the boiling point of 2-methylsulfonyl-7H-purin-6-amine? |
| A: Boiling point of 2-methylsulfonyl-7H-purin-6-amine is 415.7ºC at 760 mmHg. |
| Q: What is the CAS number of 2-methylsulfonyl-7H-purin-6-amine? |
| A: CAS number of 2-methylsulfonyl-7H-purin-6-amine is 7357-53-1. |
| Q: What is the LogP of 2-methylsulfonyl-7H-purin-6-amine? |
| A: LogP of 2-methylsulfonyl-7H-purin-6-amine is 1.00060. |
| Q: What is the polar surface area (PSA) of 2-methylsulfonyl-7H-purin-6-amine? |
| A: Polar surface area (PSA) of 2-methylsulfonyl-7H-purin-6-amine is 123.00000. |
| Q: What English synonyms does 2-methylsulfonyl-7H-purin-6-amine have? |
| A: English synonyms of 2-methylsulfonyl-7H-purin-6-amine: 2-Methylsulfonyl-adenin. |
| Q: What is the Chinese name of 7357-53-1? |
| A: Chinese name of 7357-53-1 is 7357-53-1. |
| Q: What is the English name of 2-methylsulfonyl-7H-purin-6-amine? |
| A: The English name of 2-methylsulfonyl-7H-purin-6-amine is 2-methylsulfonyl-7H-purin-6-amine. |
| Q: What is the molecular weight of 2-methylsulfonyl-7H-purin-6-amine? |
| A: Molecular weight of 2-methylsulfonyl-7H-purin-6-amine is 213.21700. |
| Q: What is the molecular formula of 2-methylsulfonyl-7H-purin-6-amine? |
| A: Molecular formula of 2-methylsulfonyl-7H-purin-6-amine is C6H7N5O2S. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |