4(3H)-Pyrimidinone,2-amino-6-[(3,4-dimethylphenyl)amino]-5-nitroso structure
|
Common Name | 4(3H)-Pyrimidinone,2-amino-6-[(3,4-dimethylphenyl)amino]-5-nitroso | ||
|---|---|---|---|---|
| CAS Number | 7357-68-8 | Molecular Weight | 259.26400 | |
| Density | 1.46g/cm3 | Boiling Point | 399.8ºC at 760 mmHg | |
| Molecular Formula | C12H13N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.6ºC | |
| Name | 2-amino-6-(3,4-dimethylanilino)-5-nitroso-1H-pyrimidin-4-one |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 399.8ºC at 760 mmHg |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.26400 |
| Flash Point | 195.6ºC |
| Exact Mass | 259.10700 |
| PSA | 113.23000 |
| LogP | 2.76460 |
| Index of Refraction | 1.696 |
| InChIKey | HXTVYWOGROSIOO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2nc(N)[nH]c(=O)c2N=O)cc1C |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|