N'-(4-nitroso-7-oxocyclohepta-1,3,5-trien-1-yl)benzohydrazide structure
|
Common Name | N'-(4-nitroso-7-oxocyclohepta-1,3,5-trien-1-yl)benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 736-25-4 | Molecular Weight | 269.25500 | |
| Density | 1.3g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-(4-nitroso-7-oxocyclohepta-1,3,5-trien-1-yl)benzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.25500 |
| Exact Mass | 269.08000 |
| PSA | 91.12000 |
| LogP | 2.84940 |
| Index of Refraction | 1.63 |
| InChIKey | FYVMVDFXQYNRKM-UHFFFAOYSA-N |
| SMILES | O=Nc1ccc(NNC(=O)c2ccccc2)c(=O)cc1 |
|
~%
N'-(4-nitroso-7... CAS#:736-25-4 |
| Literature: Sunagawa,G. et al. Chemical and Pharmaceutical Bulletin, 1963 , vol. 11, p. 1423 - 1431 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| RCH-171 |
| 2-Benzoylhydrazino-5-nitrosotropone |
| BENZOIC ACID,2-(4-NITROSO-7-OXO-1,3,5-CYCLOHEPTATRIEN-1-YL)HYDRAZIDE |
| 2-(2-Benzoyl-hydrazino)-5-nitroso-tropon |