N-[(4-chlorophenyl)carbamoyl]-2,2,3,3,3-pentafluoro-propanamide structure
|
Common Name | N-[(4-chlorophenyl)carbamoyl]-2,2,3,3,3-pentafluoro-propanamide | ||
|---|---|---|---|---|
| CAS Number | 736-45-8 | Molecular Weight | 316.61200 | |
| Density | 1.577g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H6ClF5N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-chlorophenyl)carbamoyl]-2,2,3,3,3-pentafluoropropanamide |
|---|
| Density | 1.577g/cm3 |
|---|---|
| Molecular Formula | C10H6ClF5N2O2 |
| Molecular Weight | 316.61200 |
| Exact Mass | 316.00400 |
| PSA | 58.20000 |
| LogP | 3.64960 |
| Index of Refraction | 1.5 |
| InChIKey | SNSYUWHGSZSQLA-UHFFFAOYSA-N |
| SMILES | O=C(NC(=O)C(F)(F)C(F)(F)F)Nc1ccc(Cl)cc1 |
|
~%
N-[(4-chlorophe... CAS#:736-45-8 |
| Literature: Dannley et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 1706,1708 |
|
~%
N-[(4-chlorophe... CAS#:736-45-8 |
| Literature: Dannley et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 1706,1708 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |