3-acetyl-5-bromo-1,3-benzoxazol-2-one
3-acetyl-5-bromo-1,3-benzoxazol-2-one structure
|
Common Name | 3-acetyl-5-bromo-1,3-benzoxazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 73603-52-8 | Molecular Weight | 256.05300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-acetyl-5-bromo-1,3-benzoxazol-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6BrNO3 |
|---|---|
| Molecular Weight | 256.05300 |
| Exact Mass | 254.95300 |
| PSA | 52.21000 |
| LogP | 2.01710 |
| InChIKey | MZBKBHNQNMXLGP-UHFFFAOYSA-N |
| SMILES | CC(=O)n1c(=O)oc2ccc(Br)cc21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:14733-73-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Acetyl-5-bromo-2(3H)-benzoxazolone |
| 5-Bromo-3-acetylo-benzoksazolon-2 |
| 2(3H)-BENZOXAZOLONE,3-ACETYL-5-BROMO |
| 5-Bromo-3-acetylo-benzoksazolon-2 [Polish] |
| 3-acetyl-5-bromo-1,3-benzoxazol-2(3H)-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-acetyl-5-bromo-1,3-benzoxazol-2-one? |
| A: Molecular formula of 3-acetyl-5-bromo-1,3-benzoxazol-2-one is C9H6BrNO3. |
| Q: What is the LogP of 3-acetyl-5-bromo-1,3-benzoxazol-2-one? |
| A: LogP of 3-acetyl-5-bromo-1,3-benzoxazol-2-one is 2.01710. |
| Q: What is the InChIKey of 3-acetyl-5-bromo-1,3-benzoxazol-2-one? |
| A: InChIKey of 3-acetyl-5-bromo-1,3-benzoxazol-2-one is MZBKBHNQNMXLGP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-acetyl-5-bromo-1,3-benzoxazol-2-one? |
| A: Molecular weight of 3-acetyl-5-bromo-1,3-benzoxazol-2-one is 256.05300. |
| Q: What English synonyms does 3-acetyl-5-bromo-1,3-benzoxazol-2-one have? |
| A: English synonyms of 3-acetyl-5-bromo-1,3-benzoxazol-2-one: 3-Acetyl-5-bromo-2(3H)-benzoxazolone, 5-Bromo-3-acetylo-benzoksazolon-2, 2(3H)-BENZOXAZOLONE,3-ACETYL-5-BROMO, 5-Bromo-3-acetylo-benzoksazolon-2 [Polish], 3-acetyl-5-bromo-1,3-benzoxazol-2(3H)-one. |
| Q: What is the Chinese name of 73603-52-8? |
| A: Chinese name of 73603-52-8 is 73603-52-8. |
| Q: What is the SMILES notation of 3-acetyl-5-bromo-1,3-benzoxazol-2-one? |
| A: SMILES notation of 3-acetyl-5-bromo-1,3-benzoxazol-2-one is CC(=O)n1c(=O)oc2ccc(Br)cc21. |
| Q: What are the downstream products of 3-acetyl-5-bromo-1,3-benzoxazol-2-one? |
| A: Related downstream products(CAS) of 3-acetyl-5-bromo-1,3-benzoxazol-2-one: 14733-73-4. |
| Q: What is the polar surface area (PSA) of 3-acetyl-5-bromo-1,3-benzoxazol-2-one? |
| A: Polar surface area (PSA) of 3-acetyl-5-bromo-1,3-benzoxazol-2-one is 52.21000. |
| Q: What is the CAS number of 3-acetyl-5-bromo-1,3-benzoxazol-2-one? |
| A: CAS number of 3-acetyl-5-bromo-1,3-benzoxazol-2-one is 73603-52-8. |